ChemNet > CAS > 306934-95-2 5-phenyl-2-thienylboronic acid
306934-95-2 5-phenyl-2-thienylboronic acid
Nama produk |
5-phenyl-2-thienylboronic acid |
Sinonim |
(5-Phenyl-2-thienyl)boronic acid; boronic acid, B-(5-phenyl-2-thienyl)-; (5-phenylthiophen-2-yl)boronic acid; 2-phenythiophen-5-ylboronic acid |
MF |
C10H9BO2S |
Berat Molekul |
204.0533 |
InChI |
InChI=1/C10H9BO2S/c12-11(13)10-7-6-9(14-10)8-4-2-1-3-5-8/h1-7,12-13H |
CAS NO |
306934-95-2 |
Struktur Molekul |
|
Kepadatan |
1.29g/cm3 |
Titik lebur |
146℃ |
Titik didih |
412.9°C at 760 mmHg |
Indeks bias |
1.632 |
Titik nyala |
203.5°C |
Simbol bahaya |
Xi:Irritant;
|
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|